About 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate
1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate (PubChem CID 143717743) has the molecular formula C15H35NO2
and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate.
Molecular Properties
| Compound Name | 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate |
| PubChem CID | 143717743 |
| Molecular Formula | C15H35NO2 |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.27 |
| IUPAC Name | 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate |
| SMILES | CC.CC(C)NCC(C(C)C)C(O)C1CCC1.O |
| InChI | InChI=1S/C13H27NO.C2H6.H2O/c1-9(2)12(8-14-10(3)4)13(15)11-6-5-7-11;1-2;/h9-15H,5-8H2,1-4H3;1-2H3;1H2 |
| InChIKey | UECQOHIYCBKQRJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate?
The IUPAC name of 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate (CID 143717743) is 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate.
What is the SMILES notation for 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate?
The canonical SMILES for 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate is CC.CC(C)NCC(C(C)C)C(O)C1CCC1.O.
What is the InChIKey of 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate?
The InChIKey is UECQOHIYCBKQRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO.C2H6.H2O/c1-9(2)12(8-14-10(3)4)13(15)11-6-5-7-11;1-2;/h9-15H,5-8H2,1-4H3;1-2H3;1H2.
What are the key properties of 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate?
1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate has a molecular weight of 261.45 g/mol, XLogP of 2.62, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-3-methyl-2-[(propan-2-ylamino)methyl]butan-1-ol;ethane;hydrate is sourced from PubChem (CID 143717743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).