C21H24N8OS — CID 143718385
N-diazenyl-N-[4-[[2-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]methanimidamide (PubChem CID 143718385) has the molecular formula C21H24N8OS and a molecular weight of 436.55 g/mol. Its IUPAC name is N-diazenyl-N-[4-[[2-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]methanimidamide.
| Compound Name | N-diazenyl-N-[4-[[2-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]methanimidamide |
|---|---|
| PubChem CID | 143718385 |
| Molecular Formula | C21H24N8OS |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-diazenyl-N-[4-[[2-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]methanimidamide |
| SMILES | [H]/N=C/N(/N=N/[H])c1ccc(OCc2csc(C3CCN(c4ncc(C)cn4)CC3)n2)cc1 |
| InChI | InChI=1S/C21H24N8OS/c1-15-10-24-21(25-11-15)28-8-6-16(7-9-28)20-26-17(13-31-20)12-30-19-4-2-18(3-5-19)29(14-22)27-23/h2-5,10-11,13-14,16,22-23H,6-9,12H2,1H3/b22-14+,27-23+ |
| InChIKey | ADVMRSMTSDSJRF-RHZJBGMRSA-N |
| XLogP | 4.56 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|