C23H28N8OS — CID 143718419
N-diazenyl-N-[4-[[2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]ethanimidamide (PubChem CID 143718419) has the molecular formula C23H28N8OS and a molecular weight of 464.60 g/mol. Its IUPAC name is N-diazenyl-N-[4-[[2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]ethanimidamide.
| Compound Name | N-diazenyl-N-[4-[[2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 143718419 |
| Molecular Formula | C23H28N8OS |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-diazenyl-N-[4-[[2-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-1,3-thiazol-4-yl]methoxy]phenyl]ethanimidamide |
| SMILES | [H]/N=N/N(/C(C)=N/[H])c1ccc(OCc2csc(C3CCN(c4ncc(CC)cn4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H28N8OS/c1-3-17-12-26-23(27-13-17)30-10-8-18(9-11-30)22-28-19(15-33-22)14-32-21-6-4-20(5-7-21)31(29-25)16(2)24/h4-7,12-13,15,18,24-25H,3,8-11,14H2,1-2H3/b24-16+,29-25+ |
| InChIKey | VTJJQORLRGMDOF-DOEQJSRCSA-N |
| XLogP | 5.21 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|