C28H37ClN6O5S2 — CID 143722414
(4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-2-(methanesulfonamido)-4-piperidin-4-ylidenebutanoyl]pyrrolidine-2-carboxamide (PubChem CID 143722414) has the molecular formula C28H37ClN6O5S2 and a molecular weight of 637.23 g/mol. Its IUPAC name is (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-2-(methanesulfonamido)-4-piperidin-4-ylidenebutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-2-(methanesulfonamido)-4-piperidin-4-ylidenebutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143722414 |
| Molecular Formula | C28H37ClN6O5S2 |
| Molecular Weight | 637.23 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-2-(methanesulfonamido)-4-piperidin-4-ylidenebutanoyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)C2C[C@@H](OCc3ccc(Cl)cc3)CN2C(=O)[C@@H](CC=C2CCNCC2)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H37ClN6O5S2/c1-42(38,39)34-24(7-4-18-8-10-32-11-9-18)28(37)35-15-22(40-16-19-2-5-21(29)6-3-19)13-25(35)27(36)33-14-23-12-20(17-41-23)26(30)31/h2-6,12,17,22,24-25,32,34H,7-11,13-16H2,1H3,(H3,30,31)(H,33,36)/t22-,24-,25?/m1/s1 |
| InChIKey | DTCCIQGNWJGZFC-FHLAJEGSSA-N |
| XLogP | 2.11 |
| TPSA | 166.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|