C27H36ClN5O3S — CID 143722402
(4R)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-(4-piperidin-4-ylbutanoyl)pyrrolidine-2-carboxamide (PubChem CID 143722402) has the molecular formula C27H36ClN5O3S and a molecular weight of 546.14 g/mol. Its IUPAC name is (4R)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-(4-piperidin-4-ylbutanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (4R)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-(4-piperidin-4-ylbutanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143722402 |
| Molecular Formula | C27H36ClN5O3S |
| Molecular Weight | 546.14 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | (4R)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-(4-piperidin-4-ylbutanoyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2C[C@@H](OCc3ccc(Cl)cc3)CN2C(=O)CCCC2CCNCC2)s1 |
| InChI | InChI=1S/C27H36ClN5O3S/c28-20-6-4-19(5-7-20)17-36-21-14-23(27(35)32-15-22-8-9-24(37-22)26(29)30)33(16-21)25(34)3-1-2-18-10-12-31-13-11-18/h4-9,18,21,23,31H,1-3,10-17H2,(H3,29,30)(H,32,35)/t21-,23?/m1/s1 |
| InChIKey | YQHSBQNGRJKOJU-FKHAVUOCSA-N |
| XLogP | 3.66 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|