C29H40ClN5O5S2 — CID 143722417
(4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-4-cyclohexyl-2-(methanesulfonamido)butanoyl]pyrrolidine-2-carboxamide (PubChem CID 143722417) has the molecular formula C29H40ClN5O5S2 and a molecular weight of 638.26 g/mol. Its IUPAC name is (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-4-cyclohexyl-2-(methanesulfonamido)butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-4-cyclohexyl-2-(methanesulfonamido)butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143722417 |
| Molecular Formula | C29H40ClN5O5S2 |
| Molecular Weight | 638.26 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]-1-[(2R)-4-cyclohexyl-2-(methanesulfonamido)butanoyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)C2C[C@@H](OCc3ccc(Cl)cc3)CN2C(=O)[C@@H](CCC2CCCCC2)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C29H40ClN5O5S2/c1-42(38,39)34-25(12-9-19-5-3-2-4-6-19)29(37)35-16-23(40-17-20-7-10-22(30)11-8-20)14-26(35)28(36)33-15-24-13-21(18-41-24)27(31)32/h7-8,10-11,13,18-19,23,25-26,34H,2-6,9,12,14-17H2,1H3,(H3,31,32)(H,33,36)/t23-,25-,26?/m1/s1 |
| InChIKey | JMSGHRGTGNPPGC-VVTDDVKJSA-N |
| XLogP | 3.77 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|