C26H35ClN6O3S — CID 59765393
(2S,4R)-1-(2-amino-3-piperidin-3-ylpropanoyl)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-2-carboxamide (PubChem CID 59765393) has the molecular formula C26H35ClN6O3S and a molecular weight of 547.13 g/mol. Its IUPAC name is (2S,4R)-1-(2-amino-3-piperidin-3-ylpropanoyl)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-(2-amino-3-piperidin-3-ylpropanoyl)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59765393 |
| Molecular Formula | C26H35ClN6O3S |
| Molecular Weight | 547.13 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (2S,4R)-1-(2-amino-3-piperidin-3-ylpropanoyl)-N-[(5-carbamimidoylthiophen-2-yl)methyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2C[C@@H](OCc3ccc(Cl)cc3)CN2C(=O)C(N)CC2CCCNC2)s1 |
| InChI | InChI=1S/C26H35ClN6O3S/c27-18-5-3-16(4-6-18)15-36-19-11-22(25(34)32-13-20-7-8-23(37-20)24(29)30)33(14-19)26(35)21(28)10-17-2-1-9-31-12-17/h3-8,17,19,21-22,31H,1-2,9-15,28H2,(H3,29,30)(H,32,34)/t17?,19-,21?,22+/m1/s1 |
| InChIKey | STDSNFOBWFBXGS-LBDKCUJNSA-N |
| XLogP | 2.21 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|