About 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide
2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide (PubChem CID 143725662) has the molecular formula C4H7IN4
and a molecular weight of 238.03 g/mol. Its IUPAC name is 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide.
Molecular Properties
| Compound Name | 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide |
| PubChem CID | 143725662 |
| Molecular Formula | C4H7IN4 |
| Molecular Weight | 238.03 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide |
| SMILES | C=C(N)C(=N/I)/N=C/N |
| InChI | InChI=1S/C4H7IN4/c1-3(7)4(9-5)8-2-6/h2H,1,7H2,(H2,6,8,9) |
| InChIKey | MRMJVNLUMSZWGQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.03 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide?
The IUPAC name of 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide (CID 143725662) is 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide.
What is the SMILES notation for 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide?
The canonical SMILES for 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide is C=C(N)C(=N/I)/N=C/N.
What is the InChIKey of 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide?
The InChIKey is MRMJVNLUMSZWGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7IN4/c1-3(7)4(9-5)8-2-6/h2H,1,7H2,(H2,6,8,9).
What are the key properties of 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide?
2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide has a molecular weight of 238.03 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(aminomethylidene)-N'-iodoprop-2-enimidamide is sourced from PubChem (CID 143725662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).