C26H28N2S — CID 143726733
(Z)-1-benzylsulfanyl-N-methyl-2-(methylideneamino)-2-phenylethenamine;cyclopropylbenzene (PubChem CID 143726733) has the molecular formula C26H28N2S and a molecular weight of 400.59 g/mol. Its IUPAC name is (Z)-1-benzylsulfanyl-N-methyl-2-(methylideneamino)-2-phenylethenamine;cyclopropylbenzene.
| Compound Name | (Z)-1-benzylsulfanyl-N-methyl-2-(methylideneamino)-2-phenylethenamine;cyclopropylbenzene |
|---|---|
| PubChem CID | 143726733 |
| Molecular Formula | C26H28N2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (Z)-1-benzylsulfanyl-N-methyl-2-(methylideneamino)-2-phenylethenamine;cyclopropylbenzene |
| SMILES | C=N/C(=C(/NC)SCc1ccccc1)c1ccccc1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C17H18N2S.C9H10/c1-18-16(15-11-7-4-8-12-15)17(19-2)20-13-14-9-5-3-6-10-14;1-2-4-8(5-3-1)9-6-7-9/h3-12,19H,1,13H2,2H3;1-5,9H,6-7H2/b17-16-; |
| InChIKey | WRXMISPZPSEJEQ-XYJRJTJESA-N |
| XLogP | 6.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|