About benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride
benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride (PubChem CID 18319967) has the molecular formula C24H33ClN2S2
and a molecular weight of 449.13 g/mol. Its IUPAC name is benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride.
Molecular Properties
| Compound Name | benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride |
| PubChem CID | 18319967 |
| Molecular Formula | C24H33ClN2S2 |
| Molecular Weight | 449.13 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride |
| SMILES | CN(C)Cc1ccc(C2CCC(N(C)C(=S)SCc3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C24H32N2S2.ClH/c1-25(2)17-19-9-11-21(12-10-19)22-13-15-23(16-14-22)26(3)24(27)28-18-20-7-5-4-6-8-20;/h4-12,22-23H,13-18H2,1-3H3;1H |
| InChIKey | BINAPMPXYCVUGB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.13 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride?
The IUPAC name of benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride (CID 18319967) is benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride.
What is the SMILES notation for benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride?
The canonical SMILES for benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride is CN(C)Cc1ccc(C2CCC(N(C)C(=S)SCc3ccccc3)CC2)cc1.Cl.
What is the InChIKey of benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride?
The InChIKey is BINAPMPXYCVUGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2S2.ClH/c1-25(2)17-19-9-11-21(12-10-19)22-13-15-23(16-14-22)26(3)24(27)28-18-20-7-5-4-6-8-20;/h4-12,22-23H,13-18H2,1-3H3;1H.
What are the key properties of benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride?
benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride has a molecular weight of 449.13 g/mol, XLogP of 6.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl]-N-methylcarbamodithioate;hydrochloride is sourced from PubChem (CID 18319967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).