C25H34O3S — CID 143727982
(1R,2S,3S,4R)-2-[(3-ethylphenoxy)methyl]-3-[4-[5-(1-hydroxyethenyl)thiophen-2-yl]butyl]-4-methylcyclopentan-1-ol (PubChem CID 143727982) has the molecular formula C25H34O3S and a molecular weight of 414.61 g/mol. Its IUPAC name is (1R,2S,3S,4R)-2-[(3-ethylphenoxy)methyl]-3-[4-[5-(1-hydroxyethenyl)thiophen-2-yl]butyl]-4-methylcyclopentan-1-ol.
| Compound Name | (1R,2S,3S,4R)-2-[(3-ethylphenoxy)methyl]-3-[4-[5-(1-hydroxyethenyl)thiophen-2-yl]butyl]-4-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 143727982 |
| Molecular Formula | C25H34O3S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (1R,2S,3S,4R)-2-[(3-ethylphenoxy)methyl]-3-[4-[5-(1-hydroxyethenyl)thiophen-2-yl]butyl]-4-methylcyclopentan-1-ol |
| SMILES | C=C(O)c1ccc(CCCC[C@@H]2[C@@H](COc3cccc(CC)c3)[C@H](O)C[C@H]2C)s1 |
| InChI | InChI=1S/C25H34O3S/c1-4-19-8-7-9-20(15-19)28-16-23-22(17(2)14-24(23)27)11-6-5-10-21-12-13-25(29-21)18(3)26/h7-9,12-13,15,17,22-24,26-27H,3-6,10-11,14,16H2,1-2H3/t17-,22+,23-,24-/m1/s1 |
| InChIKey | YLKVQEAZSGNSRQ-TXCSNJEZSA-N |
| XLogP | 6.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|