C11H11N3O — CID 14372833
3,4-dihydro-2H-pyrano[2,3-b][1,7]naphthyridin-5-amine (PubChem CID 14372833) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrano[2,3-b][1,7]naphthyridin-5-amine.
| Compound Name | 3,4-dihydro-2H-pyrano[2,3-b][1,7]naphthyridin-5-amine |
|---|---|
| PubChem CID | 14372833 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3,4-dihydro-2H-pyrano[2,3-b][1,7]naphthyridin-5-amine |
| SMILES | Nc1c2c(nc3cnccc13)OCCC2 |
| InChI | InChI=1S/C11H11N3O/c12-10-7-3-4-13-6-9(7)14-11-8(10)2-1-5-15-11/h3-4,6H,1-2,5H2,(H2,12,14) |
| InChIKey | HSSQLNQCMMAAPC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |