C10H13NS — CID 143728437
methyl N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethanimidothioate (PubChem CID 143728437) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is methyl N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethanimidothioate.
| Compound Name | methyl N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethanimidothioate |
|---|---|
| PubChem CID | 143728437 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | methyl N-(3-bicyclo[4.1.0]hepta-2,4-dienyl)ethanimidothioate |
| SMILES | CS/C(C)=N/C1=CC2CC2C=C1 |
| InChI | InChI=1S/C10H13NS/c1-7(12-2)11-10-4-3-8-5-9(8)6-10/h3-4,6,8-9H,5H2,1-2H3/b11-7+ |
| InChIKey | DJZJRNRQWZRVFF-YRNVUSSQSA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|