C14H25F — CID 143728594
(Z,5Z)-5-(1-fluoropropan-2-ylidene)-3,7-dimethylnon-3-ene (PubChem CID 143728594) has the molecular formula C14H25F and a molecular weight of 212.35 g/mol. Its IUPAC name is (Z,5Z)-5-(1-fluoropropan-2-ylidene)-3,7-dimethylnon-3-ene.
| Compound Name | (Z,5Z)-5-(1-fluoropropan-2-ylidene)-3,7-dimethylnon-3-ene |
|---|---|
| PubChem CID | 143728594 |
| Molecular Formula | C14H25F |
| Molecular Weight | 212.35 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (Z,5Z)-5-(1-fluoropropan-2-ylidene)-3,7-dimethylnon-3-ene |
| SMILES | CC/C(C)=C\C(CC(C)CC)=C(\C)CF |
| InChI | InChI=1S/C14H25F/c1-6-11(3)8-14(13(5)10-15)9-12(4)7-2/h8,12H,6-7,9-10H2,1-5H3/b11-8-,14-13+ |
| InChIKey | QWGJITINPZWIBU-KBABRGLLSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|