C18H32O — CID 163390649
(Z,3E)-6-butan-2-ylidene-3-ethylidene-2,8-dimethyldec-4-en-2-ol (PubChem CID 163390649) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (Z,3E)-6-butan-2-ylidene-3-ethylidene-2,8-dimethyldec-4-en-2-ol.
| Compound Name | (Z,3E)-6-butan-2-ylidene-3-ethylidene-2,8-dimethyldec-4-en-2-ol |
|---|---|
| PubChem CID | 163390649 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (Z,3E)-6-butan-2-ylidene-3-ethylidene-2,8-dimethyldec-4-en-2-ol |
| SMILES | C/C=C(\C=C/C(CC(C)CC)=C(C)CC)C(C)(C)O |
| InChI | InChI=1S/C18H32O/c1-8-14(4)13-16(15(5)9-2)11-12-17(10-3)18(6,7)19/h10-12,14,19H,8-9,13H2,1-7H3/b12-11+,16-15?,17-10+ |
| InChIKey | WENIIFWFWQKFBZ-FOZGYQLXSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|