C16H26N2 — CID 143729846
3,6-ditert-butyl-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 143729846) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3,6-ditert-butyl-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 143729846 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3,6-ditert-butyl-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1/C(C(C)(C)C)=CC=C(C(C)(C)C)/C1=N/C |
| InChI | InChI=1S/C16H26N2/c1-15(2,3)11-9-10-12(16(4,5)6)14(18-8)13(11)17-7/h9-10H,1-8H3/b17-13-,18-14- |
| InChIKey | PKICCHSHUIAMHI-JTFWXBGUSA-N |
| XLogP | 4.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|