C26H23Cl2F3N2O4 — CID 143730480
N-[7-(4-chloro-2-hydroxyphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-4,4,4-trifluoro-3-hydroxybutanamide (PubChem CID 143730480) has the molecular formula C26H23Cl2F3N2O4 and a molecular weight of 555.38 g/mol. Its IUPAC name is N-[7-(4-chloro-2-hydroxyphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-4,4,4-trifluoro-3-hydroxybutanamide.
| Compound Name | N-[7-(4-chloro-2-hydroxyphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-4,4,4-trifluoro-3-hydroxybutanamide |
|---|---|
| PubChem CID | 143730480 |
| Molecular Formula | C26H23Cl2F3N2O4 |
| Molecular Weight | 555.38 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | N-[7-(4-chloro-2-hydroxyphenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-4,4,4-trifluoro-3-hydroxybutanamide |
| SMILES | CC1(C)CC(NC(=O)CC(O)C(F)(F)F)c2cc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3O)nc2O1 |
| InChI | InChI=1S/C26H23Cl2F3N2O4/c1-25(2)12-19(32-22(36)11-21(35)26(29,30)31)18-10-17(13-3-5-14(27)6-4-13)23(33-24(18)37-25)16-8-7-15(28)9-20(16)34/h3-10,19,21,34-35H,11-12H2,1-2H3,(H,32,36) |
| InChIKey | MJFWTTVRDUEBEJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.38 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |