C7H7NO2 — CID 143732619
(2Z)-4-hydroxy-2-(1-hydroxyethenyl)penta-2,4-dienenitrile (PubChem CID 143732619) has the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. Its IUPAC name is (2Z)-4-hydroxy-2-(1-hydroxyethenyl)penta-2,4-dienenitrile.
| Compound Name | (2Z)-4-hydroxy-2-(1-hydroxyethenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 143732619 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | (2Z)-4-hydroxy-2-(1-hydroxyethenyl)penta-2,4-dienenitrile |
| SMILES | C=C(O)/C=C(/C#N)C(=C)O |
| InChI | InChI=1S/C7H7NO2/c1-5(9)3-7(4-8)6(2)10/h3,9-10H,1-2H2/b7-3- |
| InChIKey | MEJHTTMWOXSKEA-CLTKARDFSA-N |
| XLogP | 1.58 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|