C7H6FNO — CID 142974058
(3E)-3-fluoro-5-hydroxy-2-methylidenehexa-3,5-dienenitrile (PubChem CID 142974058) has the molecular formula C7H6FNO and a molecular weight of 139.13 g/mol. Its IUPAC name is (3E)-3-fluoro-5-hydroxy-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | (3E)-3-fluoro-5-hydroxy-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142974058 |
| Molecular Formula | C7H6FNO |
| Molecular Weight | 139.13 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | (3E)-3-fluoro-5-hydroxy-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C(O)/C=C(/F)C(=C)C#N |
| InChI | InChI=1S/C7H6FNO/c1-5(4-9)7(8)3-6(2)10/h3,10H,1-2H2/b7-3+ |
| InChIKey | GRKCWLWYBOUSIM-XVNBXDOJSA-N |
| XLogP | 1.99 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|