C10H15NO — CID 143198232
ethane;(2Z)-2-(1-hydroxyethenyl)-4-methylpenta-2,4-dienenitrile (PubChem CID 143198232) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;(2Z)-2-(1-hydroxyethenyl)-4-methylpenta-2,4-dienenitrile.
| Compound Name | ethane;(2Z)-2-(1-hydroxyethenyl)-4-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 143198232 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | ethane;(2Z)-2-(1-hydroxyethenyl)-4-methylpenta-2,4-dienenitrile |
| SMILES | C=C(C)/C=C(/C#N)C(=C)O.CC |
| InChI | InChI=1S/C8H9NO.C2H6/c1-6(2)4-8(5-9)7(3)10;1-2/h4,10H,1,3H2,2H3;1-2H3/b8-4-; |
| InChIKey | HWNNRLWTTMVOSP-ZYFYRQFPSA-N |
| XLogP | 3.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|