C19H16F3NO — CID 145464183
(3E,7E,11E)-3,7,11-trifluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile (PubChem CID 145464183) has the molecular formula C19H16F3NO and a molecular weight of 331.34 g/mol. Its IUPAC name is (3E,7E,11E)-3,7,11-trifluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile.
| Compound Name | (3E,7E,11E)-3,7,11-trifluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile |
|---|---|
| PubChem CID | 145464183 |
| Molecular Formula | C19H16F3NO |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (3E,7E,11E)-3,7,11-trifluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile |
| SMILES | C=C(O)/C=C(/F)C(=C)C(=C)/C=C(/F)C(=C)C(=C)/C=C(/F)C(=C)C#N |
| InChI | InChI=1S/C19H16F3NO/c1-11(7-17(20)13(3)10-23)15(5)18(21)8-12(2)16(6)19(22)9-14(4)24/h7-9,24H,1-6H2/b17-7+,18-8+,19-9+ |
| InChIKey | JEJCAAUCADFHQX-IPGLFECDSA-N |
| XLogP | 5.92 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|