C19H17F2NO — CID 145464096
(3Z,7E,11E)-7,11-difluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile (PubChem CID 145464096) has the molecular formula C19H17F2NO and a molecular weight of 313.35 g/mol. Its IUPAC name is (3Z,7E,11E)-7,11-difluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile.
| Compound Name | (3Z,7E,11E)-7,11-difluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile |
|---|---|
| PubChem CID | 145464096 |
| Molecular Formula | C19H17F2NO |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (3Z,7E,11E)-7,11-difluoro-13-hydroxy-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraenenitrile |
| SMILES | C=C(C#N)/C=C\C(=C)C(=C)/C(F)=C\C(=C)C(=C)/C(F)=C\C(=C)O |
| InChI | InChI=1S/C19H17F2NO/c1-12(11-22)7-8-13(2)16(5)18(20)9-14(3)17(6)19(21)10-15(4)23/h7-10,23H,1-6H2/b8-7-,18-9+,19-10+ |
| InChIKey | ARHXZDWOTDVLAL-OPIKGVMLSA-N |
| XLogP | 5.63 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|