C14H17NO — CID 143794627
(2E,4E,7Z)-2-ethyl-9-hydroxy-5-methyl-6-methylidenedeca-2,4,7,9-tetraenenitrile (PubChem CID 143794627) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (2E,4E,7Z)-2-ethyl-9-hydroxy-5-methyl-6-methylidenedeca-2,4,7,9-tetraenenitrile.
| Compound Name | (2E,4E,7Z)-2-ethyl-9-hydroxy-5-methyl-6-methylidenedeca-2,4,7,9-tetraenenitrile |
|---|---|
| PubChem CID | 143794627 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2E,4E,7Z)-2-ethyl-9-hydroxy-5-methyl-6-methylidenedeca-2,4,7,9-tetraenenitrile |
| SMILES | C=C(O)/C=C\C(=C)/C(C)=C\C=C(\C#N)CC |
| InChI | InChI=1S/C14H17NO/c1-5-14(10-15)9-7-12(3)11(2)6-8-13(4)16/h6-9,16H,2,4-5H2,1,3H3/b8-6-,12-7+,14-9+ |
| InChIKey | DPOVNKIUDOODTP-DXHXICTMSA-N |
| XLogP | 3.98 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|