C28H32ClN2O3S+ — CID 143733015
[1-(4-phenoxybutyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-[2-(3-chlorophenyl)thiophen-3-yl]carbamate (PubChem CID 143733015) has the molecular formula C28H32ClN2O3S+ and a molecular weight of 512.10 g/mol. Its IUPAC name is [1-(4-phenoxybutyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-[2-(3-chlorophenyl)thiophen-3-yl]carbamate.
| Compound Name | [1-(4-phenoxybutyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-[2-(3-chlorophenyl)thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 143733015 |
| Molecular Formula | C28H32ClN2O3S+ |
| Molecular Weight | 512.10 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | [1-(4-phenoxybutyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-[2-(3-chlorophenyl)thiophen-3-yl]carbamate |
| SMILES | O=C(Nc1ccsc1-c1cccc(Cl)c1)OC12CC[N+](CCCCOc3ccccc3)(CC1)CC2 |
| InChI | InChI=1S/C28H31ClN2O3S/c29-23-8-6-7-22(21-23)26-25(11-20-35-26)30-27(32)34-28-12-16-31(17-13-28,18-14-28)15-4-5-19-33-24-9-2-1-3-10-24/h1-3,6-11,20-21H,4-5,12-19H2/p+1 |
| InChIKey | CJCCXSMQYHDQNB-UHFFFAOYSA-O |
| XLogP | 7.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.10 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|