About 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate
2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate (PubChem CID 175238710) has the molecular formula C21H21ClO3S
and a molecular weight of 388.92 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate |
| PubChem CID | 175238710 |
| Molecular Formula | C21H21ClO3S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate |
| SMILES | CCOC(C)=O.Clc1cccc(-c2sccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H13ClOS.C4H8O2/c18-15-8-4-7-14(11-15)17-16(9-10-20-17)19-12-13-5-2-1-3-6-13;1-3-6-4(2)5/h1-11H,12H2;3H2,1-2H3 |
| InChIKey | YZXXCBDHZAXCJS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate?
The IUPAC name of 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate (CID 175238710) is 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate.
What is the SMILES notation for 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate?
The canonical SMILES for 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate is CCOC(C)=O.Clc1cccc(-c2sccc2OCc2ccccc2)c1.
What is the InChIKey of 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate?
The InChIKey is YZXXCBDHZAXCJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClOS.C4H8O2/c18-15-8-4-7-14(11-15)17-16(9-10-20-17)19-12-13-5-2-1-3-6-13;1-3-6-4(2)5/h1-11H,12H2;3H2,1-2H3.
What are the key properties of 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate?
2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate has a molecular weight of 388.92 g/mol, XLogP of 6.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-3-phenylmethoxythiophene;ethyl acetate is sourced from PubChem (CID 175238710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).