C25H28BrN3O3S — CID 25006198
[1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate bromide (PubChem CID 25006198) has the molecular formula C25H28BrN3O3S and a molecular weight of 530.49 g/mol. Its IUPAC name is [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate bromide.
| Compound Name | [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate bromide |
|---|---|
| PubChem CID | 25006198 |
| Molecular Formula | C25H28BrN3O3S |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | [1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate bromide |
| SMILES | O=C(Nc1ncsc1-c1ccccc1)OC12CC[N+](CCOc3ccccc3)(CC1)CC2.[Br-] |
| InChI | InChI=1S/C25H27N3O3S.BrH/c29-24(27-23-22(32-19-26-23)20-7-3-1-4-8-20)31-25-11-14-28(15-12-25,16-13-25)17-18-30-21-9-5-2-6-10-21;/h1-10,19H,11-18H2;1H |
| InChIKey | BOZLQKZRVVBWBW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|