C35H48ClNO2S — CID 143733060
2-(3-chlorophenyl)-N-[cyclobutylidene(4-propylnonan-4-yloxy)methyl]thiophen-3-amine;ethoxybenzene (PubChem CID 143733060) has the molecular formula C35H48ClNO2S and a molecular weight of 582.29 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[cyclobutylidene(4-propylnonan-4-yloxy)methyl]thiophen-3-amine;ethoxybenzene.
| Compound Name | 2-(3-chlorophenyl)-N-[cyclobutylidene(4-propylnonan-4-yloxy)methyl]thiophen-3-amine;ethoxybenzene |
|---|---|
| PubChem CID | 143733060 |
| Molecular Formula | C35H48ClNO2S |
| Molecular Weight | 582.29 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[cyclobutylidene(4-propylnonan-4-yloxy)methyl]thiophen-3-amine;ethoxybenzene |
| SMILES | CCCCCC(CCC)(CCC)OC(Nc1ccsc1-c1cccc(Cl)c1)=C1CCC1.CCOc1ccccc1 |
| InChI | InChI=1S/C27H38ClNOS.C8H10O/c1-4-7-8-18-27(16-5-2,17-6-3)30-26(21-11-9-12-21)29-24-15-19-31-25(24)22-13-10-14-23(28)20-22;1-2-9-8-6-4-3-5-7-8/h10,13-15,19-20,29H,4-9,11-12,16-18H2,1-3H3;3-7H,2H2,1H3 |
| InChIKey | UVZJMISYVBWZMK-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.29 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|