C23H35N2O4PS — CID 143733319
(1-methylcyclopropyl) 4-[3-[[2-(2-methyloxathiaphosphiran-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]oxy]propyl]piperidine-1-carboxylate (PubChem CID 143733319) has the molecular formula C23H35N2O4PS and a molecular weight of 466.58 g/mol. Its IUPAC name is (1-methylcyclopropyl) 4-[3-[[2-(2-methyloxathiaphosphiran-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]oxy]propyl]piperidine-1-carboxylate.
| Compound Name | (1-methylcyclopropyl) 4-[3-[[2-(2-methyloxathiaphosphiran-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]oxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143733319 |
| Molecular Formula | C23H35N2O4PS |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (1-methylcyclopropyl) 4-[3-[[2-(2-methyloxathiaphosphiran-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]oxy]propyl]piperidine-1-carboxylate |
| SMILES | CC1(OC(=O)N2CCC(CCCOc3ccc4c(c3)CCN(S3(C)OP3)C4)CC2)CC1 |
| InChI | InChI=1S/C23H35N2O4PS/c1-23(10-11-23)28-22(26)24-12-7-18(8-13-24)4-3-15-27-21-6-5-20-17-25(31(2)29-30-31)14-9-19(20)16-21/h5-6,16,18,30H,3-4,7-15,17H2,1-2H3 |
| InChIKey | RUTYJWJBMUYNAB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|