C24H31ClN2O4 — CID 143736753
1-(5-chloro-2-methoxyphenyl)-3-(4-cyclohexylphenyl)urea;propan-2-yl formate (PubChem CID 143736753) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(4-cyclohexylphenyl)urea;propan-2-yl formate.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-cyclohexylphenyl)urea;propan-2-yl formate |
|---|---|
| PubChem CID | 143736753 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-cyclohexylphenyl)urea;propan-2-yl formate |
| SMILES | CC(C)OC=O.COc1ccc(Cl)cc1NC(=O)Nc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H23ClN2O2.C4H8O2/c1-25-19-12-9-16(21)13-18(19)23-20(24)22-17-10-7-15(8-11-17)14-5-3-2-4-6-14;1-4(2)6-3-5/h7-14H,2-6H2,1H3,(H2,22,23,24);3-4H,1-2H3 |
| InChIKey | SSPTXTSXKNPHMY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|