C20H23ClN2O4S — CID 8615574
5-chloro-N'-(4-cyclohexylphenyl)sulfonyl-2-methoxybenzohydrazide (PubChem CID 8615574) has the molecular formula C20H23ClN2O4S and a molecular weight of 422.93 g/mol. Its IUPAC name is 5-chloro-N'-(4-cyclohexylphenyl)sulfonyl-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-(4-cyclohexylphenyl)sulfonyl-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 8615574 |
| Molecular Formula | C20H23ClN2O4S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 5-chloro-N'-(4-cyclohexylphenyl)sulfonyl-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNS(=O)(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H23ClN2O4S/c1-27-19-12-9-16(21)13-18(19)20(24)22-23-28(25,26)17-10-7-15(8-11-17)14-5-3-2-4-6-14/h7-14,23H,2-6H2,1H3,(H,22,24) |
| InChIKey | ZLMGPLBFSUZOFZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|