C18H46N4S4 — CID 143744841
N,N-dimethyl-N',N'-bis[2-[2-(methylamino)ethyldisulfanyl]ethyl]ethane-1,2-diamine;ethane (PubChem CID 143744841) has the molecular formula C18H46N4S4 and a molecular weight of 446.86 g/mol. Its IUPAC name is N,N-dimethyl-N',N'-bis[2-[2-(methylamino)ethyldisulfanyl]ethyl]ethane-1,2-diamine;ethane.
| Compound Name | N,N-dimethyl-N',N'-bis[2-[2-(methylamino)ethyldisulfanyl]ethyl]ethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143744841 |
| Molecular Formula | C18H46N4S4 |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | N,N-dimethyl-N',N'-bis[2-[2-(methylamino)ethyldisulfanyl]ethyl]ethane-1,2-diamine;ethane |
| SMILES | CC.CC.CNCCSSCCN(CCSSCCNC)CCN(C)C |
| InChI | InChI=1S/C14H34N4S4.2C2H6/c1-15-5-11-19-21-13-9-18(8-7-17(3)4)10-14-22-20-12-6-16-2;2*1-2/h15-16H,5-14H2,1-4H3;2*1-2H3 |
| InChIKey | IJOJBBNMWWHVMC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|