C10H24N4S2 — CID 154503933
1-(1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine (PubChem CID 154503933) has the molecular formula C10H24N4S2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-(1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine.
| Compound Name | 1-(1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine |
|---|---|
| PubChem CID | 154503933 |
| Molecular Formula | C10H24N4S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine |
| SMILES | CC(N)N1CCNCCSSCCNCC1 |
| InChI | InChI=1S/C10H24N4S2/c1-10(11)14-6-2-12-4-8-15-16-9-5-13-3-7-14/h10,12-13H,2-9,11H2,1H3 |
| InChIKey | DTSSAAIINGMRJM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|