C22H34N2 — CID 143745430
ethane;ethene;2-N-(4-phenylbut-1-en-2-yl)bicyclo[5.1.0]oct-3-ene-2,5-diamine (PubChem CID 143745430) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is ethane;ethene;2-N-(4-phenylbut-1-en-2-yl)bicyclo[5.1.0]oct-3-ene-2,5-diamine.
| Compound Name | ethane;ethene;2-N-(4-phenylbut-1-en-2-yl)bicyclo[5.1.0]oct-3-ene-2,5-diamine |
|---|---|
| PubChem CID | 143745430 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | ethane;ethene;2-N-(4-phenylbut-1-en-2-yl)bicyclo[5.1.0]oct-3-ene-2,5-diamine |
| SMILES | C=C.C=C(CCc1ccccc1)NC1C=CC(N)CC2CC21.CC |
| InChI | InChI=1S/C18H24N2.C2H6.C2H4/c1-13(7-8-14-5-3-2-4-6-14)20-18-10-9-16(19)11-15-12-17(15)18;2*1-2/h2-6,9-10,15-18,20H,1,7-8,11-12,19H2;1-2H3;1-2H2 |
| InChIKey | DALRCYWPPCRTNT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|