C17H23NO2S — CID 143745619
(2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide (PubChem CID 143745619) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide.
| Compound Name | (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 143745619 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide |
| SMILES | C=C/C=C(\C=C/C)CS(=O)(=O)N(CCC)c1ccccc1 |
| InChI | InChI=1S/C17H23NO2S/c1-4-10-16(11-5-2)15-21(19,20)18(14-6-3)17-12-8-7-9-13-17/h4-5,7-13H,1,6,14-15H2,2-3H3/b11-5-,16-10+ |
| InChIKey | XETRDMSINQAYIB-GJOSERSASA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|