About (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide
(2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide (PubChem CID 143745619) has the molecular formula C17H23NO2S
and a molecular weight of 305.44 g/mol. Its IUPAC name is (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide |
| PubChem CID | 143745619 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide |
| SMILES | C=C/C=C(\C=C/C)CS(=O)(=O)N(CCC)c1ccccc1 |
| InChI | InChI=1S/C17H23NO2S/c1-4-10-16(11-5-2)15-21(19,20)18(14-6-3)17-12-8-7-9-13-17/h4-5,7-13H,1,6,14-15H2,2-3H3/b11-5-,16-10+ |
| InChIKey | XETRDMSINQAYIB-GJOSERSASA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide?
The IUPAC name of (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide (CID 143745619) is (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide.
What is the SMILES notation for (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide?
The canonical SMILES for (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide is C=C/C=C(\C=C/C)CS(=O)(=O)N(CCC)c1ccccc1.
What is the InChIKey of (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide?
The InChIKey is XETRDMSINQAYIB-GJOSERSASA-N. The full InChI is InChI=1S/C17H23NO2S/c1-4-10-16(11-5-2)15-21(19,20)18(14-6-3)17-12-8-7-9-13-17/h4-5,7-13H,1,6,14-15H2,2-3H3/b11-5-,16-10+.
What are the key properties of (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide?
(2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide has a molecular weight of 305.44 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-phenyl-2-[(Z)-prop-1-enyl]-N-propylpenta-2,4-diene-1-sulfonamide is sourced from PubChem (CID 143745619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).