C24H28F2N6O — CID 143749288
2-amino-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide;1-piperidin-4-ylpyrazole-4-carbaldehyde (PubChem CID 143749288) has the molecular formula C24H28F2N6O and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-amino-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide;1-piperidin-4-ylpyrazole-4-carbaldehyde.
| Compound Name | 2-amino-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide;1-piperidin-4-ylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 143749288 |
| Molecular Formula | C24H28F2N6O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-amino-5-[(3,5-difluorophenyl)methyl]-N'-methylbenzenecarboximidamide;1-piperidin-4-ylpyrazole-4-carbaldehyde |
| SMILES | C/N=C(\N)c1cc(Cc2cc(F)cc(F)c2)ccc1N.O=Cc1cnn(C2CCNCC2)c1 |
| InChI | InChI=1S/C15H15F2N3.C9H13N3O/c1-20-15(19)13-7-9(2-3-14(13)18)4-10-5-11(16)8-12(17)6-10;13-7-8-5-11-12(6-8)9-1-3-10-4-2-9/h2-3,5-8H,4,18H2,1H3,(H2,19,20);5-7,9-10H,1-4H2 |
| InChIKey | RRTPCZHWQXJPEV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|