C18H21FINO4S — CID 143751061
ethyl (6S)-6-[[4-fluoro-2-(1λ3-iodacyclobuten-2-yl)phenyl]sulfamoyl]cyclohexene-1-carboxylate (PubChem CID 143751061) has the molecular formula C18H21FINO4S and a molecular weight of 493.34 g/mol. Its IUPAC name is ethyl (6S)-6-[[4-fluoro-2-(1λ3-iodacyclobuten-2-yl)phenyl]sulfamoyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl (6S)-6-[[4-fluoro-2-(1λ3-iodacyclobuten-2-yl)phenyl]sulfamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 143751061 |
| Molecular Formula | C18H21FINO4S |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | ethyl (6S)-6-[[4-fluoro-2-(1λ3-iodacyclobuten-2-yl)phenyl]sulfamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCC[C@@H]1S(=O)(=O)Nc1ccc(F)cc1C1=ICC1 |
| InChI | InChI=1S/C18H21FINO4S/c1-2-25-18(22)13-5-3-4-6-17(13)26(23,24)21-16-8-7-12(19)11-14(16)15-9-10-20-15/h5,7-8,11,17,21H,2-4,6,9-10H2,1H3/t17-/m0/s1 |
| InChIKey | MFWQOYNSQBLICE-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|