C26H40N6O5 — CID 143753459
tert-butyl 2-hydroxyacetate;N'-[[4-(2,4-dimethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]-N,N'-dimethylpropane-1,3-diamine (PubChem CID 143753459) has the molecular formula C26H40N6O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is tert-butyl 2-hydroxyacetate;N'-[[4-(2,4-dimethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | tert-butyl 2-hydroxyacetate;N'-[[4-(2,4-dimethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143753459 |
| Molecular Formula | C26H40N6O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | tert-butyl 2-hydroxyacetate;N'-[[4-(2,4-dimethoxyanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CC(C)(C)OC(=O)CO.CNCCCN(C)Cc1c[nH]c2ncnc(Nc3ccc(OC)cc3OC)c12 |
| InChI | InChI=1S/C20H28N6O2.C6H12O3/c1-21-8-5-9-26(2)12-14-11-22-19-18(14)20(24-13-23-19)25-16-7-6-15(27-3)10-17(16)28-4;1-6(2,3)9-5(8)4-7/h6-7,10-11,13,21H,5,8-9,12H2,1-4H3,(H2,22,23,24,25);7H,4H2,1-3H3 |
| InChIKey | KOZUQFOITXCKGG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|