C10H20N2 — CID 143754539
[(3aS,6aS)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydrocyclopenta[b]pyrrol-2-yl]methanamine (PubChem CID 143754539) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is [(3aS,6aS)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydrocyclopenta[b]pyrrol-2-yl]methanamine.
| Compound Name | [(3aS,6aS)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydrocyclopenta[b]pyrrol-2-yl]methanamine |
|---|---|
| PubChem CID | 143754539 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | [(3aS,6aS)-3a,6a-dimethyl-1,2,3,4,5,6-hexahydrocyclopenta[b]pyrrol-2-yl]methanamine |
| SMILES | C[C@@]12CCC[C@]1(C)NC(CN)C2 |
| InChI | InChI=1S/C10H20N2/c1-9-4-3-5-10(9,2)12-8(6-9)7-11/h8,12H,3-7,11H2,1-2H3/t8?,9-,10-/m0/s1 |
| InChIKey | WAWROLJVSBRIFL-AGROOBSYSA-N |
| XLogP | 1.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |