C9H18N2O2 — CID 19883310
1,5-dioxa-9-azaspiro[5.5]undecan-10-ylmethanamine (PubChem CID 19883310) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1,5-dioxa-9-azaspiro[5.5]undecan-10-ylmethanamine.
| Compound Name | 1,5-dioxa-9-azaspiro[5.5]undecan-10-ylmethanamine |
|---|---|
| PubChem CID | 19883310 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1,5-dioxa-9-azaspiro[5.5]undecan-10-ylmethanamine |
| SMILES | NCC1CC2(CCN1)OCCCO2 |
| InChI | InChI=1S/C9H18N2O2/c10-7-8-6-9(2-3-11-8)12-4-1-5-13-9/h8,11H,1-7,10H2 |
| InChIKey | BQDZLWBJFXGBQS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |