C21H31N — CID 143756281
6a-methyl-3-[(3E)-penta-1,3-dien-3-yl]-3aH-cyclopropa[g]indole;butane;ethane (PubChem CID 143756281) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is 6a-methyl-3-[(3E)-penta-1,3-dien-3-yl]-3aH-cyclopropa[g]indole;butane;ethane.
| Compound Name | 6a-methyl-3-[(3E)-penta-1,3-dien-3-yl]-3aH-cyclopropa[g]indole;butane;ethane |
|---|---|
| PubChem CID | 143756281 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 6a-methyl-3-[(3E)-penta-1,3-dien-3-yl]-3aH-cyclopropa[g]indole;butane;ethane |
| SMILES | C=C/C(=C\C)C1=CN=C2C1C=CC1=CC12C.CC.CCCC |
| InChI | InChI=1S/C15H15N.C4H10.C2H6/c1-4-10(5-2)13-9-16-14-12(13)7-6-11-8-15(11,14)3;1-3-4-2;1-2/h4-9,12H,1H2,2-3H3;3-4H2,1-2H3;1-2H3/b10-5+;; |
| InChIKey | OYAHNUYSFPWUTO-XKYXOGKGSA-N |
| XLogP | 6.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|