C8H12N2O — CID 143759338
5,7-diamino-5-methylcyclohepta-1,3,6-trien-1-ol (PubChem CID 143759338) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 5,7-diamino-5-methylcyclohepta-1,3,6-trien-1-ol.
| Compound Name | 5,7-diamino-5-methylcyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 143759338 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 5,7-diamino-5-methylcyclohepta-1,3,6-trien-1-ol |
| SMILES | CC1(N)C=CC=C(O)C(N)=C1 |
| InChI | InChI=1S/C8H12N2O/c1-8(10)4-2-3-7(11)6(9)5-8/h2-5,11H,9-10H2,1H3 |
| InChIKey | XXGRJBNXHNUZDW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |