C18H16F2N3O- — CID 143762483
(2Z)-N-(diaminomethyl)-7-fluoro-8-(4-fluorophenyl)-5,6-dihydronaphthalene-2-carboximidate (PubChem CID 143762483) has the molecular formula C18H16F2N3O- and a molecular weight of 328.34 g/mol. Its IUPAC name is (2Z)-N-(diaminomethyl)-7-fluoro-8-(4-fluorophenyl)-5,6-dihydronaphthalene-2-carboximidate.
| Compound Name | (2Z)-N-(diaminomethyl)-7-fluoro-8-(4-fluorophenyl)-5,6-dihydronaphthalene-2-carboximidate |
|---|---|
| PubChem CID | 143762483 |
| Molecular Formula | C18H16F2N3O- |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2Z)-N-(diaminomethyl)-7-fluoro-8-(4-fluorophenyl)-5,6-dihydronaphthalene-2-carboximidate |
| SMILES | NC(N)/N=C(\[O-])c1ccc2c(c1)C(c1ccc(F)cc1)=C(F)CC2 |
| InChI | InChI=1S/C18H17F2N3O/c19-13-6-3-11(4-7-13)16-14-9-12(17(24)23-18(21)22)2-1-10(14)5-8-15(16)20/h1-4,6-7,9,18H,5,8,21-22H2,(H,23,24)/p-1 |
| InChIKey | DOFDOWOZCKQWEL-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|