C16H22NO- — CID 59280746
N,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carboximidate (PubChem CID 59280746) has the molecular formula C16H22NO- and a molecular weight of 244.36 g/mol. Its IUPAC name is N,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carboximidate.
| Compound Name | N,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carboximidate |
|---|---|
| PubChem CID | 59280746 |
| Molecular Formula | C16H22NO- |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carboximidate |
| SMILES | C/N=C(\[O-])c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C16H23NO/c1-15(2)8-9-16(3,4)13-10-11(14(18)17-5)6-7-12(13)15/h6-7,10H,8-9H2,1-5H3,(H,17,18)/p-1 |
| InChIKey | XBLWURJSGAVUMC-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|