C22H19F3N2O — CID 143910322
amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate (PubChem CID 143910322) has the molecular formula C22H19F3N2O and a molecular weight of 384.40 g/mol. Its IUPAC name is amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate.
| Compound Name | amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 143910322 |
| Molecular Formula | C22H19F3N2O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate |
| SMILES | Cc1ccc(C/N=C(\ON)c2ccc(-c3ccccc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H19F3N2O/c1-15-7-9-16(10-8-15)14-27-21(28-26)18-11-12-19(17-5-3-2-4-6-17)20(13-18)22(23,24)25/h2-13H,14,26H2,1H3/b27-21- |
| InChIKey | IHUOABIBNIQSCE-MEFGMAGPSA-N |
| XLogP | 5.52 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|