C26H26F3N3O — CID 143910011
amino 4-phenyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-(trifluoromethyl)benzenecarboximidate (PubChem CID 143910011) has the molecular formula C26H26F3N3O and a molecular weight of 453.51 g/mol. Its IUPAC name is amino 4-phenyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-(trifluoromethyl)benzenecarboximidate.
| Compound Name | amino 4-phenyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 143910011 |
| Molecular Formula | C26H26F3N3O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | amino 4-phenyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-3-(trifluoromethyl)benzenecarboximidate |
| SMILES | NO/C(=N\Cc1ccc(CN2CCCC2)cc1)c1ccc(-c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26F3N3O/c27-26(28,29)24-16-22(12-13-23(24)21-6-2-1-3-7-21)25(33-30)31-17-19-8-10-20(11-9-19)18-32-14-4-5-15-32/h1-3,6-13,16H,4-5,14-15,17-18,30H2/b31-25- |
| InChIKey | XLRGCCQBMZYDKE-GDWJVWIDSA-N |
| XLogP | 5.81 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|