C26H28F3N3O — CID 143910321
amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate;pyrrolidine (PubChem CID 143910321) has the molecular formula C26H28F3N3O and a molecular weight of 455.52 g/mol. Its IUPAC name is amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate;pyrrolidine.
| Compound Name | amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate;pyrrolidine |
|---|---|
| PubChem CID | 143910321 |
| Molecular Formula | C26H28F3N3O |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | amino N-[(4-methylphenyl)methyl]-4-phenyl-3-(trifluoromethyl)benzenecarboximidate;pyrrolidine |
| SMILES | C1CCNC1.Cc1ccc(C/N=C(\ON)c2ccc(-c3ccccc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H19F3N2O.C4H9N/c1-15-7-9-16(10-8-15)14-27-21(28-26)18-11-12-19(17-5-3-2-4-6-17)20(13-18)22(23,24)25;1-2-4-5-3-1/h2-13H,14,26H2,1H3;5H,1-4H2/b27-21-; |
| InChIKey | NBERZUYPJLFBJS-DJILMAANSA-N |
| XLogP | 5.89 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|