C13H14ClF2N3OS — CID 143764351
(Z)-3-amino-2-aminosulfanyl-N-[(2-chloro-3,6-difluorophenyl)methyl]-3-cyclopropylprop-2-enamide (PubChem CID 143764351) has the molecular formula C13H14ClF2N3OS and a molecular weight of 333.79 g/mol. Its IUPAC name is (Z)-3-amino-2-aminosulfanyl-N-[(2-chloro-3,6-difluorophenyl)methyl]-3-cyclopropylprop-2-enamide.
| Compound Name | (Z)-3-amino-2-aminosulfanyl-N-[(2-chloro-3,6-difluorophenyl)methyl]-3-cyclopropylprop-2-enamide |
|---|---|
| PubChem CID | 143764351 |
| Molecular Formula | C13H14ClF2N3OS |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (Z)-3-amino-2-aminosulfanyl-N-[(2-chloro-3,6-difluorophenyl)methyl]-3-cyclopropylprop-2-enamide |
| SMILES | NS/C(C(=O)NCc1c(F)ccc(F)c1Cl)=C(\N)C1CC1 |
| InChI | InChI=1S/C13H14ClF2N3OS/c14-10-7(8(15)3-4-9(10)16)5-19-13(20)12(21-18)11(17)6-1-2-6/h3-4,6H,1-2,5,17-18H2,(H,19,20)/b12-11- |
| InChIKey | VEAMYRUNDMIJPU-QXMHVHEDSA-N |
| XLogP | 2.42 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|