C25H33N3O2 — CID 143766184
N-tert-butyl-3-[[4-(2,4-dimethylbenzoyl)piperazin-1-yl]methyl]benzamide (PubChem CID 143766184) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-tert-butyl-3-[[4-(2,4-dimethylbenzoyl)piperazin-1-yl]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[4-(2,4-dimethylbenzoyl)piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 143766184 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-tert-butyl-3-[[4-(2,4-dimethylbenzoyl)piperazin-1-yl]methyl]benzamide |
| SMILES | Cc1ccc(C(=O)N2CCN(Cc3cccc(C(=O)NC(C)(C)C)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-18-9-10-22(19(2)15-18)24(30)28-13-11-27(12-14-28)17-20-7-6-8-21(16-20)23(29)26-25(3,4)5/h6-10,15-16H,11-14,17H2,1-5H3,(H,26,29) |
| InChIKey | JERUCYYZQVQHCR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |