C28H37F2N5O3 — CID 25191626
N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-2,3-difluorobenzoyl]piperazin-1-yl]methyl]benzamide (PubChem CID 25191626) has the molecular formula C28H37F2N5O3 and a molecular weight of 529.63 g/mol. Its IUPAC name is N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-2,3-difluorobenzoyl]piperazin-1-yl]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-2,3-difluorobenzoyl]piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 25191626 |
| Molecular Formula | C28H37F2N5O3 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-2,3-difluorobenzoyl]piperazin-1-yl]methyl]benzamide |
| SMILES | CCCCNC(=O)Nc1ccc(C(=O)N2CCN(Cc3cccc(C(=O)NC(C)(C)C)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C28H37F2N5O3/c1-5-6-12-31-27(38)32-22-11-10-21(23(29)24(22)30)26(37)35-15-13-34(14-16-35)18-19-8-7-9-20(17-19)25(36)33-28(2,3)4/h7-11,17H,5-6,12-16,18H2,1-4H3,(H,33,36)(H2,31,32,38) |
| InChIKey | ZHCQWBOETGQDSF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|