C28H38ClN5O3 — CID 25191507
N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-3-chlorobenzoyl]piperazin-1-yl]methyl]benzamide (PubChem CID 25191507) has the molecular formula C28H38ClN5O3 and a molecular weight of 528.10 g/mol. Its IUPAC name is N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-3-chlorobenzoyl]piperazin-1-yl]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-3-chlorobenzoyl]piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 25191507 |
| Molecular Formula | C28H38ClN5O3 |
| Molecular Weight | 528.10 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-tert-butyl-3-[[4-[4-(butylcarbamoylamino)-3-chlorobenzoyl]piperazin-1-yl]methyl]benzamide |
| SMILES | CCCCNC(=O)Nc1ccc(C(=O)N2CCN(Cc3cccc(C(=O)NC(C)(C)C)c3)CC2)cc1Cl |
| InChI | InChI=1S/C28H38ClN5O3/c1-5-6-12-30-27(37)31-24-11-10-22(18-23(24)29)26(36)34-15-13-33(14-16-34)19-20-8-7-9-21(17-20)25(35)32-28(2,3)4/h7-11,17-18H,5-6,12-16,19H2,1-4H3,(H,32,35)(H2,30,31,37) |
| InChIKey | AHSOSIHYTOLWSJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.10 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|